About (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide
(2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide (PubChem CID 95269319) has the molecular formula C14H25N3O4
and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide.
Molecular Properties
| Compound Name | (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide |
| PubChem CID | 95269319 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)N1CCC(C2OCCO2)CC1 |
| InChI | InChI=1S/C14H25N3O4/c1-3-15-14(19)16-12(18)10(2)17-6-4-11(5-7-17)13-20-8-9-21-13/h10-11,13H,3-9H2,1-2H3,(H2,15,16,18,19)/t10-/m1/s1 |
| InChIKey | YAYAMGPHDOBYGZ-SNVBAGLBSA-N |
| XLogP | 0.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide?
The IUPAC name of (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide (CID 95269319) is (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide.
What is the SMILES notation for (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide?
The canonical SMILES for (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide is CCNC(=O)NC(=O)[C@@H](C)N1CCC(C2OCCO2)CC1.
What is the InChIKey of (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide?
The InChIKey is YAYAMGPHDOBYGZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H25N3O4/c1-3-15-14(19)16-12(18)10(2)17-6-4-11(5-7-17)13-20-8-9-21-13/h10-11,13H,3-9H2,1-2H3,(H2,15,16,18,19)/t10-/m1/s1.
What are the key properties of (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide?
(2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide has a molecular weight of 299.37 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-(1,3-dioxolan-2-yl)piperidin-1-yl]-N-(ethylcarbamoyl)propanamide is sourced from PubChem (CID 95269319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).