C15H15BrFN3O — CID 61340199
1-[3-(1-aminoethyl)phenyl]-3-(2-bromo-4-fluorophenyl)urea (PubChem CID 61340199) has the molecular formula C15H15BrFN3O and a molecular weight of 352.21 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)phenyl]-3-(2-bromo-4-fluorophenyl)urea.
| Compound Name | 1-[3-(1-aminoethyl)phenyl]-3-(2-bromo-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 61340199 |
| Molecular Formula | C15H15BrFN3O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-[3-(1-aminoethyl)phenyl]-3-(2-bromo-4-fluorophenyl)urea |
| SMILES | CC(N)c1cccc(NC(=O)Nc2ccc(F)cc2Br)c1 |
| InChI | InChI=1S/C15H15BrFN3O/c1-9(18)10-3-2-4-12(7-10)19-15(21)20-14-6-5-11(17)8-13(14)16/h2-9H,18H2,1H3,(H2,19,20,21) |
| InChIKey | FVELEVLUSYDQEG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |