C17H21N3O — CID 61341644
1-[3-(1-aminoethyl)phenyl]-3-(2,4-dimethylphenyl)urea (PubChem CID 61341644) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)phenyl]-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-[3-(1-aminoethyl)phenyl]-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 61341644 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[3-(1-aminoethyl)phenyl]-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(C(C)N)c2)c(C)c1 |
| InChI | InChI=1S/C17H21N3O/c1-11-7-8-16(12(2)9-11)20-17(21)19-15-6-4-5-14(10-15)13(3)18/h4-10,13H,18H2,1-3H3,(H2,19,20,21) |
| InChIKey | WTQLPRMYNBDZCQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |