C6H9N7O — CID 61342865
N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 61342865) has the molecular formula C6H9N7O and a molecular weight of 195.19 g/mol. Its IUPAC name is N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61342865 |
| Molecular Formula | C6H9N7O |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | [N-]=[N+]=NCCNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C6H9N7O/c7-12-10-2-1-9-6(14)3-13-5-8-4-11-13/h4-5H,1-3H2,(H,9,14) |
| InChIKey | HAPYYOSUNHFVKT-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|