C11H17N5O — CID 61344561
N-(3-azidopropyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 61344561) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is N-(3-azidopropyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(3-azidopropyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61344561 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-(3-azidopropyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cccc1C(=O)NCCCN=[N+]=[N-] |
| InChI | InChI=1S/C11H17N5O/c1-9(2)16-8-3-5-10(16)11(17)13-6-4-7-14-15-12/h3,5,8-9H,4,6-7H2,1-2H3,(H,13,17) |
| InChIKey | KGDOWOZXMNCNHK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|