C11H15N3O5 — CID 61344775
ethyl 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]propanoate (PubChem CID 61344775) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 61344775 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | ethyl 2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H15N3O5/c1-3-19-11(18)7(2)12-9(16)6-14-10(17)5-4-8(15)13-14/h4-5,7H,3,6H2,1-2H3,(H,12,16)(H,13,15) |
| InChIKey | XNFZSCFHDUUHQM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |