C8H9FN2O4 — CID 81296720
ethyl 2-(3,6-dioxo-1H-pyridazin-2-yl)-2-fluoroacetate (PubChem CID 81296720) has the molecular formula C8H9FN2O4 and a molecular weight of 216.17 g/mol. Its IUPAC name is ethyl 2-(3,6-dioxo-1H-pyridazin-2-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(3,6-dioxo-1H-pyridazin-2-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 81296720 |
| Molecular Formula | C8H9FN2O4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | ethyl 2-(3,6-dioxo-1H-pyridazin-2-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)n1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H9FN2O4/c1-2-15-8(14)7(9)11-6(13)4-3-5(12)10-11/h3-4,7H,2H2,1H3,(H,10,12) |
| InChIKey | SGJKDJBOVPGWRP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |