C11H14N2O6 — CID 88749825
2-methylpropoxycarbonyl 2-(3,6-dioxo-1H-pyridazin-2-yl)acetate (PubChem CID 88749825) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl 2-(3,6-dioxo-1H-pyridazin-2-yl)acetate.
| Compound Name | 2-methylpropoxycarbonyl 2-(3,6-dioxo-1H-pyridazin-2-yl)acetate |
|---|---|
| PubChem CID | 88749825 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-methylpropoxycarbonyl 2-(3,6-dioxo-1H-pyridazin-2-yl)acetate |
| SMILES | CC(C)COC(=O)OC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H14N2O6/c1-7(2)6-18-11(17)19-10(16)5-13-9(15)4-3-8(14)12-13/h3-4,7H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | OLQRCTDQXHDSBJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|