C11H24N2 — CID 61348599
N'-cyclohexyl-N'-propylethane-1,2-diamine (PubChem CID 61348599) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-cyclohexyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-cyclohexyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 61348599 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-cyclohexyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN)C1CCCCC1 |
| InChI | InChI=1S/C11H24N2/c1-2-9-13(10-8-12)11-6-4-3-5-7-11/h11H,2-10,12H2,1H3 |
| InChIKey | AZNQPEXZNSWNLV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |