C16H13ClN2O2 — CID 61355070
1-[(6-chloro-3-pyridinyl)methyl]-5,7-dimethylindole-2,3-dione (PubChem CID 61355070) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5,7-dimethylindole-2,3-dione.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,7-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 61355070 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,7-dimethylindole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H13ClN2O2/c1-9-5-10(2)14-12(6-9)15(20)16(21)19(14)8-11-3-4-13(17)18-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | XPCASFZGJXZFHU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|