C14H11NO3S — CID 61356112
5-methoxy-1-(thiophen-2-ylmethyl)indole-2,3-dione (PubChem CID 61356112) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-methoxy-1-(thiophen-2-ylmethyl)indole-2,3-dione.
| Compound Name | 5-methoxy-1-(thiophen-2-ylmethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 61356112 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-methoxy-1-(thiophen-2-ylmethyl)indole-2,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2Cc1cccs1 |
| InChI | InChI=1S/C14H11NO3S/c1-18-9-4-5-12-11(7-9)13(16)14(17)15(12)8-10-3-2-6-19-10/h2-7H,8H2,1H3 |
| InChIKey | ULKWCSLBPLGDJQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|