C29H27NO5 — CID 6135650
(4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-naphthalen-1-yl-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6135650) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-naphthalen-1-yl-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-naphthalen-1-yl-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6135650 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-naphthalen-1-yl-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(/C(O)=C3\C(=O)C(=O)N(CC4CCCO4)C3c3cccc4ccccc34)ccc2O1 |
| InChI | InChI=1S/C29H27NO5/c1-17-14-20-15-19(11-12-24(20)35-17)27(31)25-26(23-10-4-7-18-6-2-3-9-22(18)23)30(29(33)28(25)32)16-21-8-5-13-34-21/h2-4,6-7,9-12,15,17,21,26,31H,5,8,13-14,16H2,1H3/b27-25+ |
| InChIKey | SESQSSLMOMXFKP-IMVLJIQESA-N |
| XLogP | 4.76 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|