C24H24N2O5 — CID 7103398
(5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-5-pyridin-4-ylpyrrolidine-2,3-dione (PubChem CID 7103398) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-5-pyridin-4-ylpyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-5-pyridin-4-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7103398 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (5R)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-5-pyridin-4-ylpyrrolidine-2,3-dione |
| SMILES | C[C@H]1Cc2cc(C(O)=C3C(=O)C(=O)N(C[C@@H]4CCCO4)[C@@H]3c3ccncc3)ccc2O1 |
| InChI | InChI=1S/C24H24N2O5/c1-14-11-17-12-16(4-5-19(17)31-14)22(27)20-21(15-6-8-25-9-7-15)26(24(29)23(20)28)13-18-3-2-10-30-18/h4-9,12,14,18,21,27H,2-3,10-11,13H2,1H3/t14-,18-,21+/m0/s1 |
| InChIKey | VYSVXTPBFZHYTG-DHUIEDIVSA-N |
| XLogP | 3.01 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|