C16H27N3 — CID 61363093
N-amino-N'-tert-butyl-3-methyl-2-phenylpentanimidamide (PubChem CID 61363093) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-3-methyl-2-phenylpentanimidamide.
| Compound Name | N-amino-N'-tert-butyl-3-methyl-2-phenylpentanimidamide |
|---|---|
| PubChem CID | 61363093 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-amino-N'-tert-butyl-3-methyl-2-phenylpentanimidamide |
| SMILES | CCC(C)C(/C(=N\C(C)(C)C)NN)c1ccccc1 |
| InChI | InChI=1S/C16H27N3/c1-6-12(2)14(13-10-8-7-9-11-13)15(19-17)18-16(3,4)5/h7-12,14H,6,17H2,1-5H3,(H,18,19) |
| InChIKey | SURQTDKFNWYGCZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|