C11H13N3O2S — CID 61368397
2-(cyclopropylmethylsulfonyl)-3H-benzimidazol-5-amine (PubChem CID 61368397) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfonyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(cyclopropylmethylsulfonyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 61368397 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(cyclopropylmethylsulfonyl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)CC3CC3)[nH]c2c1 |
| InChI | InChI=1S/C11H13N3O2S/c12-8-3-4-9-10(5-8)14-11(13-9)17(15,16)6-7-1-2-7/h3-5,7H,1-2,6,12H2,(H,13,14) |
| InChIKey | ZSIFTORASYUNOZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|