C14H12IN3O2S — CID 65477729
2-[(4-iodophenyl)methylsulfonyl]-3H-benzimidazol-5-amine (PubChem CID 65477729) has the molecular formula C14H12IN3O2S and a molecular weight of 413.24 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methylsulfonyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[(4-iodophenyl)methylsulfonyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 65477729 |
| Molecular Formula | C14H12IN3O2S |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 2-[(4-iodophenyl)methylsulfonyl]-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)Cc3ccc(I)cc3)[nH]c2c1 |
| InChI | InChI=1S/C14H12IN3O2S/c15-10-3-1-9(2-4-10)8-21(19,20)14-17-12-6-5-11(16)7-13(12)18-14/h1-7H,8,16H2,(H,17,18) |
| InChIKey | HXAJVCLQVKGATD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|