C10H16N2O2 — CID 61371044
2-[methyl-[(2-methylfuran-3-yl)methyl]amino]propanamide (PubChem CID 61371044) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[methyl-[(2-methylfuran-3-yl)methyl]amino]propanamide.
| Compound Name | 2-[methyl-[(2-methylfuran-3-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 61371044 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-[methyl-[(2-methylfuran-3-yl)methyl]amino]propanamide |
| SMILES | Cc1occc1CN(C)C(C)C(N)=O |
| InChI | InChI=1S/C10H16N2O2/c1-7(10(11)13)12(3)6-9-4-5-14-8(9)2/h4-5,7H,6H2,1-3H3,(H2,11,13) |
| InChIKey | VYXILRBYEKNETM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |