C11H16ClNO2 — CID 62729105
3-chloro-N,2-dimethyl-N-[(2-methylfuran-3-yl)methyl]propanamide (PubChem CID 62729105) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-[(2-methylfuran-3-yl)methyl]propanamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-[(2-methylfuran-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 62729105 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-[(2-methylfuran-3-yl)methyl]propanamide |
| SMILES | Cc1occc1CN(C)C(=O)C(C)CCl |
| InChI | InChI=1S/C11H16ClNO2/c1-8(6-12)11(14)13(3)7-10-4-5-15-9(10)2/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | IITITXIWZYHTKW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|