About cyclohexyl 2-pyrrolidin-2-ylacetate
cyclohexyl 2-pyrrolidin-2-ylacetate (PubChem CID 61372710) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is cyclohexyl 2-pyrrolidin-2-ylacetate.
Molecular Properties
| Compound Name | cyclohexyl 2-pyrrolidin-2-ylacetate |
| PubChem CID | 61372710 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | cyclohexyl 2-pyrrolidin-2-ylacetate |
| SMILES | O=C(CC1CCCN1)OC1CCCCC1 |
| InChI | InChI=1S/C12H21NO2/c14-12(9-10-5-4-8-13-10)15-11-6-2-1-3-7-11/h10-11,13H,1-9H2 |
| InChIKey | VSVBTSBIYRNGPS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl 2-pyrrolidin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-pyrrolidin-2-ylacetate?
The IUPAC name of cyclohexyl 2-pyrrolidin-2-ylacetate (CID 61372710) is cyclohexyl 2-pyrrolidin-2-ylacetate.
What is the SMILES notation for cyclohexyl 2-pyrrolidin-2-ylacetate?
The canonical SMILES for cyclohexyl 2-pyrrolidin-2-ylacetate is O=C(CC1CCCN1)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-pyrrolidin-2-ylacetate?
The InChIKey is VSVBTSBIYRNGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c14-12(9-10-5-4-8-13-10)15-11-6-2-1-3-7-11/h10-11,13H,1-9H2.
What are the key properties of cyclohexyl 2-pyrrolidin-2-ylacetate?
cyclohexyl 2-pyrrolidin-2-ylacetate has a molecular weight of 211.30 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-pyrrolidin-2-ylacetate is sourced from PubChem (CID 61372710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).