C12H20N2O — CID 61373669
N-[(2-propan-2-yloxy-3-pyridinyl)methyl]propan-1-amine (PubChem CID 61373669) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[(2-propan-2-yloxy-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(2-propan-2-yloxy-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 61373669 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[(2-propan-2-yloxy-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cccnc1OC(C)C |
| InChI | InChI=1S/C12H20N2O/c1-4-7-13-9-11-6-5-8-14-12(11)15-10(2)3/h5-6,8,10,13H,4,7,9H2,1-3H3 |
| InChIKey | SNMKCCUONYFQKR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|