C14H24N4O2 — CID 77031333
N'-hydroxy-5-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pentanimidamide (PubChem CID 77031333) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N'-hydroxy-5-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pentanimidamide.
| Compound Name | N'-hydroxy-5-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pentanimidamide |
|---|---|
| PubChem CID | 77031333 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N'-hydroxy-5-[(2-propan-2-yloxy-3-pyridinyl)methylamino]pentanimidamide |
| SMILES | CC(C)Oc1ncccc1CNCCCCC(N)=NO |
| InChI | InChI=1S/C14H24N4O2/c1-11(2)20-14-12(6-5-9-17-14)10-16-8-4-3-7-13(15)18-19/h5-6,9,11,16,19H,3-4,7-8,10H2,1-2H3,(H2,15,18) |
| InChIKey | GQOVNEPHUYTTJW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|