C13H19N5O — CID 62756157
N-[(1-methyltriazol-4-yl)methyl]-1-(2-propan-2-yloxy-3-pyridinyl)methanamine (PubChem CID 62756157) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-[(1-methyltriazol-4-yl)methyl]-1-(2-propan-2-yloxy-3-pyridinyl)methanamine.
| Compound Name | N-[(1-methyltriazol-4-yl)methyl]-1-(2-propan-2-yloxy-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 62756157 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-[(1-methyltriazol-4-yl)methyl]-1-(2-propan-2-yloxy-3-pyridinyl)methanamine |
| SMILES | CC(C)Oc1ncccc1CNCc1cn(C)nn1 |
| InChI | InChI=1S/C13H19N5O/c1-10(2)19-13-11(5-4-6-15-13)7-14-8-12-9-18(3)17-16-12/h4-6,9-10,14H,7-8H2,1-3H3 |
| InChIKey | AQPKLLDNKCABAG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |