C12H15BrFN — CID 61383412
6-bromo-4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 61383412) has the molecular formula C12H15BrFN and a molecular weight of 272.16 g/mol. Its IUPAC name is 6-bromo-4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-bromo-4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 61383412 |
| Molecular Formula | C12H15BrFN |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 6-bromo-4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1CCc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C12H15BrFN/c1-2-5-15-12-4-3-9-10(12)6-8(13)7-11(9)14/h6-7,12,15H,2-5H2,1H3 |
| InChIKey | BDNVFAMTVHDQRD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |