C14H14BrNO4 — CID 61389922
2-[(7-bromo-1-benzofuran-2-carbonyl)amino]pentanoic acid (PubChem CID 61389922) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 61389922 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[(7-bromo-1-benzofuran-2-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1cc2cccc(Br)c2o1)C(=O)O |
| InChI | InChI=1S/C14H14BrNO4/c1-2-4-10(14(18)19)16-13(17)11-7-8-5-3-6-9(15)12(8)20-11/h3,5-7,10H,2,4H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | FQYOUEPTIZGHCB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |