C15H16BrNO2 — CID 61390451
2-bromo-6-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)methyl]phenol (PubChem CID 61390451) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-bromo-6-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)methyl]phenol.
| Compound Name | 2-bromo-6-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 61390451 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-bromo-6-[(4,5,6,7-tetrahydro-1-benzofuran-4-ylamino)methyl]phenol |
| SMILES | Oc1c(Br)cccc1CNC1CCCc2occc21 |
| InChI | InChI=1S/C15H16BrNO2/c16-12-4-1-3-10(15(12)18)9-17-13-5-2-6-14-11(13)7-8-19-14/h1,3-4,7-8,13,17-18H,2,5-6,9H2 |
| InChIKey | LYMSOHHPABGAEH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|