C12H12BrNO3 — CID 61390786
2-(2-bromo-6-formylphenoxy)-N-prop-2-enylacetamide (PubChem CID 61390786) has the molecular formula C12H12BrNO3 and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-(2-bromo-6-formylphenoxy)-N-prop-2-enylacetamide.
| Compound Name | 2-(2-bromo-6-formylphenoxy)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 61390786 |
| Molecular Formula | C12H12BrNO3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-(2-bromo-6-formylphenoxy)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1c(Br)cccc1C=O |
| InChI | InChI=1S/C12H12BrNO3/c1-2-6-14-11(16)8-17-12-9(7-15)4-3-5-10(12)13/h2-5,7H,1,6,8H2,(H,14,16) |
| InChIKey | VNUFNLCEDADHCX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|