About 2-pyrazin-2-yloxybenzoic acid
2-pyrazin-2-yloxybenzoic acid (PubChem CID 61395597) has the molecular formula C11H8N2O3
and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-pyrazin-2-yloxybenzoic acid.
Molecular Properties
| Compound Name | 2-pyrazin-2-yloxybenzoic acid |
| PubChem CID | 61395597 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-pyrazin-2-yloxybenzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1cnccn1 |
| InChI | InChI=1S/C11H8N2O3/c14-11(15)8-3-1-2-4-9(8)16-10-7-12-5-6-13-10/h1-7H,(H,14,15) |
| InChIKey | JTFCANJNVOODKY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrazin-2-yloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-yloxybenzoic acid?
The IUPAC name of 2-pyrazin-2-yloxybenzoic acid (CID 61395597) is 2-pyrazin-2-yloxybenzoic acid.
What is the SMILES notation for 2-pyrazin-2-yloxybenzoic acid?
The canonical SMILES for 2-pyrazin-2-yloxybenzoic acid is O=C(O)c1ccccc1Oc1cnccn1.
What is the InChIKey of 2-pyrazin-2-yloxybenzoic acid?
The InChIKey is JTFCANJNVOODKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3/c14-11(15)8-3-1-2-4-9(8)16-10-7-12-5-6-13-10/h1-7H,(H,14,15).
What are the key properties of 2-pyrazin-2-yloxybenzoic acid?
2-pyrazin-2-yloxybenzoic acid has a molecular weight of 216.20 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-yloxybenzoic acid is sourced from PubChem (CID 61395597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).