C10H8INOS — CID 61400116
2-(4-iodophenoxy)-4-methyl-1,3-thiazole (PubChem CID 61400116) has the molecular formula C10H8INOS and a molecular weight of 317.15 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-4-methyl-1,3-thiazole.
| Compound Name | 2-(4-iodophenoxy)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 61400116 |
| Molecular Formula | C10H8INOS |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2-(4-iodophenoxy)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(Oc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C10H8INOS/c1-7-6-14-10(12-7)13-9-4-2-8(11)3-5-9/h2-6H,1H3 |
| InChIKey | DAJDBBANWPTNOT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|