C11H10IN3O — CID 114448087
3-(4-iodophenoxy)-5,6-dimethyl-1,2,4-triazine (PubChem CID 114448087) has the molecular formula C11H10IN3O and a molecular weight of 327.13 g/mol. Its IUPAC name is 3-(4-iodophenoxy)-5,6-dimethyl-1,2,4-triazine.
| Compound Name | 3-(4-iodophenoxy)-5,6-dimethyl-1,2,4-triazine |
|---|---|
| PubChem CID | 114448087 |
| Molecular Formula | C11H10IN3O |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-(4-iodophenoxy)-5,6-dimethyl-1,2,4-triazine |
| SMILES | Cc1nnc(Oc2ccc(I)cc2)nc1C |
| InChI | InChI=1S/C11H10IN3O/c1-7-8(2)14-15-11(13-7)16-10-5-3-9(12)4-6-10/h3-6H,1-2H3 |
| InChIKey | HKMXVWTUGNOPSO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|