C12H17N3O4 — CID 61403137
4-[2-aminoethylcarbamoyl(2-hydroxyethyl)amino]benzoic acid (PubChem CID 61403137) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[2-aminoethylcarbamoyl(2-hydroxyethyl)amino]benzoic acid.
| Compound Name | 4-[2-aminoethylcarbamoyl(2-hydroxyethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61403137 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-[2-aminoethylcarbamoyl(2-hydroxyethyl)amino]benzoic acid |
| SMILES | NCCNC(=O)N(CCO)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H17N3O4/c13-5-6-14-12(19)15(7-8-16)10-3-1-9(2-4-10)11(17)18/h1-4,16H,5-8,13H2,(H,14,19)(H,17,18) |
| InChIKey | LNWYCSGJEZDYFE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |