C21H21Br2N3O5 — CID 6140770
(E)-3-(3,5-dibromo-2-methoxyphenyl)-1-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 6140770) has the molecular formula C21H21Br2N3O5 and a molecular weight of 555.22 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-2-methoxyphenyl)-1-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-1-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6140770 |
| Molecular Formula | C21H21Br2N3O5 |
| Molecular Weight | 555.22 g/mol |
| Exact Mass | 552.98 |
| IUPAC Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-1-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)/C=C/c3cc(Br)cc(Br)c3OC)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21Br2N3O5/c1-30-16-4-5-18(19(13-16)26(28)29)24-7-9-25(10-8-24)20(27)6-3-14-11-15(22)12-17(23)21(14)31-2/h3-6,11-13H,7-10H2,1-2H3/b6-3+ |
| InChIKey | XTNFKBWMYFRFMN-ZZXKWVIFSA-N |
| XLogP | 4.50 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|