C17H17NO2S — CID 61411636
5-(3-hydroxyprop-1-ynyl)-N-methyl-N-[(3-methylphenyl)methyl]thiophene-2-carboxamide (PubChem CID 61411636) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-methyl-N-[(3-methylphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-methyl-N-[(3-methylphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61411636 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-methyl-N-[(3-methylphenyl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(CN(C)C(=O)c2ccc(C#CCO)s2)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-13-5-3-6-14(11-13)12-18(2)17(20)16-9-8-15(21-16)7-4-10-19/h3,5-6,8-9,11,19H,10,12H2,1-2H3 |
| InChIKey | FNIHAXLVGPHCIH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|