C13H20FN3O2S — CID 61413404
N-[(4-fluorophenyl)methyl]-N-methyl-1,4-diazepane-1-sulfonamide (PubChem CID 61413404) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-1,4-diazepane-1-sulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 61413404 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-1,4-diazepane-1-sulfonamide |
| SMILES | CN(Cc1ccc(F)cc1)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C13H20FN3O2S/c1-16(11-12-3-5-13(14)6-4-12)20(18,19)17-9-2-7-15-8-10-17/h3-6,15H,2,7-11H2,1H3 |
| InChIKey | KQSVSAKTIPOCBG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |