C10H11ClN2O2S — CID 6141778
(Z)-N'-(2-chloroacetyl)-3-(3-methylthiophen-2-yl)prop-2-enehydrazide (PubChem CID 6141778) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is (Z)-N'-(2-chloroacetyl)-3-(3-methylthiophen-2-yl)prop-2-enehydrazide.
| Compound Name | (Z)-N'-(2-chloroacetyl)-3-(3-methylthiophen-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 6141778 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (Z)-N'-(2-chloroacetyl)-3-(3-methylthiophen-2-yl)prop-2-enehydrazide |
| SMILES | Cc1ccsc1/C=C\C(=O)NNC(=O)CCl |
| InChI | InChI=1S/C10H11ClN2O2S/c1-7-4-5-16-8(7)2-3-9(14)12-13-10(15)6-11/h2-5H,6H2,1H3,(H,12,14)(H,13,15)/b3-2- |
| InChIKey | UIVDXUGTDHQRMO-IHWYPQMZSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|