C13H18N4S — CID 61418378
2-(1,4-thiazepan-4-ylmethyl)-3H-benzimidazol-5-amine (PubChem CID 61418378) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-(1,4-thiazepan-4-ylmethyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(1,4-thiazepan-4-ylmethyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 61418378 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(1,4-thiazepan-4-ylmethyl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(CN3CCCSCC3)[nH]c2c1 |
| InChI | InChI=1S/C13H18N4S/c14-10-2-3-11-12(8-10)16-13(15-11)9-17-4-1-6-18-7-5-17/h2-3,8H,1,4-7,9,14H2,(H,15,16) |
| InChIKey | OGAGUAYZNWVCJE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|