C16H24N4 — CID 65283216
2-[(4,4-dimethylazepan-1-yl)methyl]-3H-benzimidazol-5-amine (PubChem CID 65283216) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 2-[(4,4-dimethylazepan-1-yl)methyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[(4,4-dimethylazepan-1-yl)methyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 65283216 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-[(4,4-dimethylazepan-1-yl)methyl]-3H-benzimidazol-5-amine |
| SMILES | CC1(C)CCCN(Cc2nc3ccc(N)cc3[nH]2)CC1 |
| InChI | InChI=1S/C16H24N4/c1-16(2)6-3-8-20(9-7-16)11-15-18-13-5-4-12(17)10-14(13)19-15/h4-5,10H,3,6-9,11,17H2,1-2H3,(H,18,19) |
| InChIKey | LOVOYSUVEFGLRI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|