C13H19N3O5 — CID 61420678
(2S)-5-amino-2-[[ethyl(furan-2-ylmethyl)carbamoyl]amino]-5-oxopentanoic acid (PubChem CID 61420678) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S)-5-amino-2-[[ethyl(furan-2-ylmethyl)carbamoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[ethyl(furan-2-ylmethyl)carbamoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61420678 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2S)-5-amino-2-[[ethyl(furan-2-ylmethyl)carbamoyl]amino]-5-oxopentanoic acid |
| SMILES | CCN(Cc1ccco1)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-2-16(8-9-4-3-7-21-9)13(20)15-10(12(18)19)5-6-11(14)17/h3-4,7,10H,2,5-6,8H2,1H3,(H2,14,17)(H,15,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | GWTOEHKXJKBJCB-JTQLQIEISA-N |
| XLogP | 0.53 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |