C12H19N3O5 — CID 173458645
(2S)-5-amino-2-(methylamino)-5-oxopentanoic acid;N-[2-(furan-2-yl)ethylidene]hydroxylamine (PubChem CID 173458645) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2S)-5-amino-2-(methylamino)-5-oxopentanoic acid;N-[2-(furan-2-yl)ethylidene]hydroxylamine.
| Compound Name | (2S)-5-amino-2-(methylamino)-5-oxopentanoic acid;N-[2-(furan-2-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 173458645 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2S)-5-amino-2-(methylamino)-5-oxopentanoic acid;N-[2-(furan-2-yl)ethylidene]hydroxylamine |
| SMILES | CN[C@@H](CCC(N)=O)C(=O)O.ON=CCc1ccco1 |
| InChI | InChI=1S/C6H12N2O3.C6H7NO2/c1-8-4(6(10)11)2-3-5(7)9;8-7-4-3-6-2-1-5-9-6/h4,8H,2-3H2,1H3,(H2,7,9)(H,10,11);1-2,4-5,8H,3H2/t4-;/m0./s1 |
| InChIKey | JRWVJHAMDISORE-WCCKRBBISA-N |
| XLogP | 0.21 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|