C12H20N2O — CID 61422604
2-N-(furan-3-ylmethyl)-2-N-methylcyclohexane-1,2-diamine (PubChem CID 61422604) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-N-(furan-3-ylmethyl)-2-N-methylcyclohexane-1,2-diamine.
| Compound Name | 2-N-(furan-3-ylmethyl)-2-N-methylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 61422604 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-N-(furan-3-ylmethyl)-2-N-methylcyclohexane-1,2-diamine |
| SMILES | CN(Cc1ccoc1)C1CCCCC1N |
| InChI | InChI=1S/C12H20N2O/c1-14(8-10-6-7-15-9-10)12-5-3-2-4-11(12)13/h6-7,9,11-12H,2-5,8,13H2,1H3 |
| InChIKey | XGQDTSWDTIYDQR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |