C10H16N2O2 — CID 63702901
4-[furan-3-ylmethyl(methyl)amino]pyrrolidin-3-ol (PubChem CID 63702901) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-[furan-3-ylmethyl(methyl)amino]pyrrolidin-3-ol.
| Compound Name | 4-[furan-3-ylmethyl(methyl)amino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 63702901 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-[furan-3-ylmethyl(methyl)amino]pyrrolidin-3-ol |
| SMILES | CN(Cc1ccoc1)C1CNCC1O |
| InChI | InChI=1S/C10H16N2O2/c1-12(6-8-2-3-14-7-8)9-4-11-5-10(9)13/h2-3,7,9-11,13H,4-6H2,1H3 |
| InChIKey | FBOMVIKUWHREIM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |