C9H14N2O2 — CID 126847141
(3R,4R)-4-(furan-3-ylmethylamino)pyrrolidin-3-ol (PubChem CID 126847141) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3R,4R)-4-(furan-3-ylmethylamino)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(furan-3-ylmethylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126847141 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3R,4R)-4-(furan-3-ylmethylamino)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CNC[C@H]1NCc1ccoc1 |
| InChI | InChI=1S/C9H14N2O2/c12-9-5-10-4-8(9)11-3-7-1-2-13-6-7/h1-2,6,8-12H,3-5H2/t8-,9-/m1/s1 |
| InChIKey | NXAGYEDZALVVHC-RKDXNWHRSA-N |
| XLogP | -0.30 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |