C14H15NO — CID 115711462
N-(furan-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 115711462) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(furan-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 115711462 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1ccc2c(c1)CC(NCc1ccoc1)C2 |
| InChI | InChI=1S/C14H15NO/c1-2-4-13-8-14(7-12(13)3-1)15-9-11-5-6-16-10-11/h1-6,10,14-15H,7-9H2 |
| InChIKey | ZMKJACDIWWVXCS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |