C10H16N2O — CID 116680458
2-(azetidin-3-yl)-N-(furan-3-ylmethyl)ethanamine (PubChem CID 116680458) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(furan-3-ylmethyl)ethanamine.
| Compound Name | 2-(azetidin-3-yl)-N-(furan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 116680458 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(furan-3-ylmethyl)ethanamine |
| SMILES | c1cc(CNCCC2CNC2)co1 |
| InChI | InChI=1S/C10H16N2O/c1(9-5-12-6-9)3-11-7-10-2-4-13-8-10/h2,4,8-9,11-12H,1,3,5-7H2 |
| InChIKey | QJIFKWLFZIIKSI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|