C11H14N4S2 — CID 61434903
3-[cyclopropyl(thiophen-3-ylmethyl)amino]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 61434903) has the molecular formula C11H14N4S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-[cyclopropyl(thiophen-3-ylmethyl)amino]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[cyclopropyl(thiophen-3-ylmethyl)amino]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 61434903 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-[cyclopropyl(thiophen-3-ylmethyl)amino]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(N(Cc2ccsc2)C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C11H14N4S2/c1-14-10(12-13-11(14)16)15(9-2-3-9)6-8-4-5-17-7-8/h4-5,7,9H,2-3,6H2,1H3,(H,13,16) |
| InChIKey | LKTOURFADPCSJM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|