C14H23N3O2S — CID 61435229
4-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide (PubChem CID 61435229) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61435229 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-hydrazinyl-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCC(N(C)S(=O)(=O)c2ccc(NN)cc2)CC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-11-3-7-13(8-4-11)17(2)20(18,19)14-9-5-12(16-15)6-10-14/h5-6,9-11,13,16H,3-4,7-8,15H2,1-2H3 |
| InChIKey | HXKAVZRLRHNEPZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|