C15H21Cl2N3 — CID 61441053
2-(4-cyclopropylpiperazin-1-yl)-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 61441053) has the molecular formula C15H21Cl2N3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(4-cyclopropylpiperazin-1-yl)-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | 2-(4-cyclopropylpiperazin-1-yl)-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 61441053 |
| Molecular Formula | C15H21Cl2N3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(4-cyclopropylpiperazin-1-yl)-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | NCC(c1ccc(Cl)c(Cl)c1)N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C15H21Cl2N3/c16-13-4-1-11(9-14(13)17)15(10-18)20-7-5-19(6-8-20)12-2-3-12/h1,4,9,12,15H,2-3,5-8,10,18H2 |
| InChIKey | QKUMRMAUPSOSML-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |