C14H21Cl2N3 — CID 43105682
2-(3,4-dichlorophenyl)-2-(4-methyl-1,4-diazepan-1-yl)ethanamine (PubChem CID 43105682) has the molecular formula C14H21Cl2N3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-(4-methyl-1,4-diazepan-1-yl)ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-2-(4-methyl-1,4-diazepan-1-yl)ethanamine |
|---|---|
| PubChem CID | 43105682 |
| Molecular Formula | C14H21Cl2N3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-(4-methyl-1,4-diazepan-1-yl)ethanamine |
| SMILES | CN1CCCN(C(CN)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H21Cl2N3/c1-18-5-2-6-19(8-7-18)14(10-17)11-3-4-12(15)13(16)9-11/h3-4,9,14H,2,5-8,10,17H2,1H3 |
| InChIKey | HXWYMDIUTYAIHQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |