C17H24N4 — CID 63968294
2-(4-methyl-1,4-diazepan-1-yl)-2-quinolin-6-ylethanamine (PubChem CID 63968294) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)-2-quinolin-6-ylethanamine.
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)-2-quinolin-6-ylethanamine |
|---|---|
| PubChem CID | 63968294 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)-2-quinolin-6-ylethanamine |
| SMILES | CN1CCCN(C(CN)c2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C17H24N4/c1-20-8-3-9-21(11-10-20)17(13-18)15-5-6-16-14(12-15)4-2-7-19-16/h2,4-7,12,17H,3,8-11,13,18H2,1H3 |
| InChIKey | YDEAKSQUUFWWID-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |