C15H21FN4 — CID 61442079
2-fluoro-N-methyl-4-[1-(methylamino)ethyl]-N-[(1-methylpyrazol-4-yl)methyl]aniline (PubChem CID 61442079) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-[1-(methylamino)ethyl]-N-[(1-methylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2-fluoro-N-methyl-4-[1-(methylamino)ethyl]-N-[(1-methylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 61442079 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-fluoro-N-methyl-4-[1-(methylamino)ethyl]-N-[(1-methylpyrazol-4-yl)methyl]aniline |
| SMILES | CNC(C)c1ccc(N(C)Cc2cnn(C)c2)c(F)c1 |
| InChI | InChI=1S/C15H21FN4/c1-11(17-2)13-5-6-15(14(16)7-13)19(3)9-12-8-18-20(4)10-12/h5-8,10-11,17H,9H2,1-4H3 |
| InChIKey | LILIBXSHMTXPKH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|