C15H21FN4 — CID 63815488
2-(2-aminopropyl)-4-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline (PubChem CID 63815488) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(2-aminopropyl)-4-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2-(2-aminopropyl)-4-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 63815488 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-(2-aminopropyl)-4-fluoro-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
| SMILES | CC(N)Cc1cc(F)ccc1N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C15H21FN4/c1-11(17)6-13-7-14(16)4-5-15(13)19(2)9-12-8-18-20(3)10-12/h4-5,7-8,10-11H,6,9,17H2,1-3H3 |
| InChIKey | XVXAMIMUHPSTEY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |